C28H24N2O3S — CID 2172101
[(4R)-4-(3-ethoxy-4-prop-2-ynoxyphenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone (PubChem CID 2172101) has the molecular formula C28H24N2O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is [(4R)-4-(3-ethoxy-4-prop-2-ynoxyphenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone.
| Compound Name | [(4R)-4-(3-ethoxy-4-prop-2-ynoxyphenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 2172101 |
| Molecular Formula | C28H24N2O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | [(4R)-4-(3-ethoxy-4-prop-2-ynoxyphenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone |
| SMILES | C#CCOc1ccc([C@H]2NC(=S)NC(c3ccccc3)=C2C(=O)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C28H24N2O3S/c1-3-17-33-22-16-15-21(18-23(22)32-4-2)26-24(27(31)20-13-9-6-10-14-20)25(29-28(34)30-26)19-11-7-5-8-12-19/h1,5-16,18,26H,4,17H2,2H3,(H2,29,30,34)/t26-/m1/s1 |
| InChIKey | SRENPUNLLNQRJL-AREMUKBSSA-N |
| XLogP | 4.91 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|