C25H21N3O3S — CID 1302579
2-[4-[(4R)-5-benzoyl-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]phenoxy]acetamide (PubChem CID 1302579) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-[4-[(4R)-5-benzoyl-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]phenoxy]acetamide.
| Compound Name | 2-[4-[(4R)-5-benzoyl-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 1302579 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[4-[(4R)-5-benzoyl-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc([C@H]2NC(=S)NC(c3ccccc3)=C2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3O3S/c26-20(29)15-31-19-13-11-17(12-14-19)23-21(24(30)18-9-5-2-6-10-18)22(27-25(32)28-23)16-7-3-1-4-8-16/h1-14,23H,15H2,(H2,26,29)(H2,27,28,32)/t23-/m1/s1 |
| InChIKey | VJDYJABJKMEORE-HSZRJFAPSA-N |
| XLogP | 3.36 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|