C13H14N2OS2 — CID 2178898
(5Z)-1,3-dimethyl-5-[(4-methylsulfanylphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 2178898) has the molecular formula C13H14N2OS2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (5Z)-1,3-dimethyl-5-[(4-methylsulfanylphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-1,3-dimethyl-5-[(4-methylsulfanylphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 2178898 |
| Molecular Formula | C13H14N2OS2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (5Z)-1,3-dimethyl-5-[(4-methylsulfanylphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CSc1ccc(/C=C2/C(=O)N(C)C(=S)N2C)cc1 |
| InChI | InChI=1S/C13H14N2OS2/c1-14-11(12(16)15(2)13(14)17)8-9-4-6-10(18-3)7-5-9/h4-8H,1-3H3/b11-8- |
| InChIKey | CPPDNIVLZXKPMJ-FLIBITNWSA-N |
| XLogP | 2.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|