C15H10Cl2N3O4- — CID 2180482
2-[(5-acetamido-2,4-dichlorophenyl)iminomethyl]-4-nitrophenolate (PubChem CID 2180482) has the molecular formula C15H10Cl2N3O4- and a molecular weight of 367.17 g/mol. Its IUPAC name is 2-[(5-acetamido-2,4-dichlorophenyl)iminomethyl]-4-nitrophenolate.
| Compound Name | 2-[(5-acetamido-2,4-dichlorophenyl)iminomethyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 2180482 |
| Molecular Formula | C15H10Cl2N3O4- |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 2-[(5-acetamido-2,4-dichlorophenyl)iminomethyl]-4-nitrophenolate |
| SMILES | CC(=O)Nc1cc(/N=C/c2cc([N+](=O)[O-])ccc2[O-])c(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2N3O4/c1-8(21)19-14-6-13(11(16)5-12(14)17)18-7-9-4-10(20(23)24)2-3-15(9)22/h2-7,22H,1H3,(H,19,21)/p-1/b18-7+ |
| InChIKey | NNNPSKILMFENTC-CNHKJKLMSA-M |
| XLogP | 3.68 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|