C14H14Cl2N2O5 — CID 2180550
ethyl (Z)-2-(2,4-dichloro-5-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate (PubChem CID 2180550) has the molecular formula C14H14Cl2N2O5 and a molecular weight of 361.18 g/mol. Its IUPAC name is ethyl (Z)-2-(2,4-dichloro-5-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate.
| Compound Name | ethyl (Z)-2-(2,4-dichloro-5-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate |
|---|---|
| PubChem CID | 2180550 |
| Molecular Formula | C14H14Cl2N2O5 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | ethyl (Z)-2-(2,4-dichloro-5-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\N(C)C)C(=O)c1cc([N+](=O)[O-])c(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O5/c1-4-23-14(20)9(7-17(2)3)13(19)8-5-12(18(21)22)11(16)6-10(8)15/h5-7H,4H2,1-3H3/b9-7- |
| InChIKey | VAGGYVYRJORKFY-CLFYSBASSA-N |
| XLogP | 3.09 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|