C15H26NO+ — CID 2184599
[(2S)-butan-2-yl]-[3-(3-ethylphenoxy)propyl]azanium (PubChem CID 2184599) has the molecular formula C15H26NO+ and a molecular weight of 236.38 g/mol. Its IUPAC name is [(2S)-butan-2-yl]-[3-(3-ethylphenoxy)propyl]azanium.
| Compound Name | [(2S)-butan-2-yl]-[3-(3-ethylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 2184599 |
| Molecular Formula | C15H26NO+ |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | [(2S)-butan-2-yl]-[3-(3-ethylphenoxy)propyl]azanium |
| SMILES | CCc1cccc(OCCC[NH2+][C@@H](C)CC)c1 |
| InChI | InChI=1S/C15H25NO/c1-4-13(3)16-10-7-11-17-15-9-6-8-14(5-2)12-15/h6,8-9,12-13,16H,4-5,7,10-11H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | IMVMASUMAJULST-ZDUSSCGKSA-O |
| XLogP | 2.38 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|