C23H20NO8S- — CID 2187470
3-[[2-methoxy-4-[(Z)-[3-[(2R)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 2187470) has the molecular formula C23H20NO8S- and a molecular weight of 470.48 g/mol. Its IUPAC name is 3-[[2-methoxy-4-[(Z)-[3-[(2R)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | 3-[[2-methoxy-4-[(Z)-[3-[(2R)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 2187470 |
| Molecular Formula | C23H20NO8S- |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 3-[[2-methoxy-4-[(Z)-[3-[(2R)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)[C@@H](C)N1C(=O)S/C(=C\c2ccc(OCc3cccc(C(=O)[O-])c3)c(OC)c2)C1=O |
| InChI | InChI=1S/C23H21NO8S/c1-13(22(28)31-3)24-20(25)19(33-23(24)29)11-14-7-8-17(18(10-14)30-2)32-12-15-5-4-6-16(9-15)21(26)27/h4-11,13H,12H2,1-3H3,(H,26,27)/p-1/b19-11-/t13-/m1/s1 |
| InChIKey | AEYZLJFVCQFXSX-LPXFMOJISA-M |
| XLogP | 2.24 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|