C8H16O3 — CID 21902
2,2-Diethyl-1,3-dioxolane-4-methanol (PubChem CID 21902) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2,2-diethyl-1,3-dioxolan-4-yl)methanol.
| Compound Name | 2,2-Diethyl-1,3-dioxolane-4-methanol |
|---|---|
| PubChem CID | 21902 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2,2-diethyl-1,3-dioxolan-4-yl)methanol |
| SMILES | CCC1(OCC(O1)CO)CC |
| InChI | InChI=1S/C8H16O3/c1-3-8(4-2)10-6-7(5-9)11-8/h7,9H,3-6H2,1-2H3 |
| InChIKey | WEIVFXLGBXCVEF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 38.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | 121 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |