C24H16FNO4S2 — CID 2191167
[3-[(Z)-[3-(2-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-fluorobenzoate (PubChem CID 2191167) has the molecular formula C24H16FNO4S2 and a molecular weight of 465.53 g/mol. Its IUPAC name is [3-[(Z)-[3-(2-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-fluorobenzoate.
| Compound Name | [3-[(Z)-[3-(2-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 2191167 |
| Molecular Formula | C24H16FNO4S2 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | [3-[(Z)-[3-(2-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-fluorobenzoate |
| SMILES | COc1ccccc1N1C(=O)/C(=C/c2cccc(OC(=O)c3ccccc3F)c2)SC1=S |
| InChI | InChI=1S/C24H16FNO4S2/c1-29-20-12-5-4-11-19(20)26-22(27)21(32-24(26)31)14-15-7-6-8-16(13-15)30-23(28)17-9-2-3-10-18(17)25/h2-14H,1H3/b21-14- |
| InChIKey | PATOKGHAIUMDKW-STZFKDTASA-N |
| XLogP | 5.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|