C24H16INO4S2 — CID 46495830
[3-[(Z)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-iodobenzoate (PubChem CID 46495830) has the molecular formula C24H16INO4S2 and a molecular weight of 573.43 g/mol. Its IUPAC name is [3-[(Z)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-iodobenzoate.
| Compound Name | [3-[(Z)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 46495830 |
| Molecular Formula | C24H16INO4S2 |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 572.96 |
| IUPAC Name | [3-[(Z)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-iodobenzoate |
| SMILES | COc1ccc(N2C(=O)/C(=C/c3cccc(OC(=O)c4ccccc4I)c3)SC2=S)cc1 |
| InChI | InChI=1S/C24H16INO4S2/c1-29-17-11-9-16(10-12-17)26-22(27)21(32-24(26)31)14-15-5-4-6-18(13-15)30-23(28)19-7-2-3-8-20(19)25/h2-14H,1H3/b21-14- |
| InChIKey | KYIGOESTFPXIHG-STZFKDTASA-N |
| XLogP | 5.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|