C14H13N4O4S- — CID 2191458
2-[[4-(2-methylprop-2-enyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 2191458) has the molecular formula C14H13N4O4S- and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-[[4-(2-methylprop-2-enyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | 2-[[4-(2-methylprop-2-enyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 2191458 |
| Molecular Formula | C14H13N4O4S- |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-[[4-(2-methylprop-2-enyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | C=C(C)Cn1c(SCC(=O)[O-])nnc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H14N4O4S/c1-9(2)7-17-13(15-16-14(17)23-8-12(19)20)10-3-5-11(6-4-10)18(21)22/h3-6H,1,7-8H2,2H3,(H,19,20)/p-1 |
| InChIKey | BVHKEBYIBWWWRD-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 113.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|