C15H16N3O3S- — CID 7385323
2-[[4-(2-methylprop-2-enyl)-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 7385323) has the molecular formula C15H16N3O3S- and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-[[4-(2-methylprop-2-enyl)-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | 2-[[4-(2-methylprop-2-enyl)-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 7385323 |
| Molecular Formula | C15H16N3O3S- |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-[[4-(2-methylprop-2-enyl)-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | C=C(C)Cn1c(COc2ccccc2)nnc1SCC(=O)[O-] |
| InChI | InChI=1S/C15H17N3O3S/c1-11(2)8-18-13(9-21-12-6-4-3-5-7-12)16-17-15(18)22-10-14(19)20/h3-7H,1,8-10H2,2H3,(H,19,20)/p-1 |
| InChIKey | NZVQSEPRNJZLRT-UHFFFAOYSA-M |
| XLogP | 1.28 |
| TPSA | 80.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|