C15H18N4O4S3 — CID 2192287
1-(4-sulfamoylphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]thiourea (PubChem CID 2192287) has the molecular formula C15H18N4O4S3 and a molecular weight of 414.53 g/mol. Its IUPAC name is 1-(4-sulfamoylphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]thiourea.
| Compound Name | 1-(4-sulfamoylphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 2192287 |
| Molecular Formula | C15H18N4O4S3 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 1-(4-sulfamoylphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]thiourea |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=S)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C15H18N4O4S3/c16-25(20,21)13-5-1-11(2-6-13)9-10-18-15(24)19-12-3-7-14(8-4-12)26(17,22)23/h1-8H,9-10H2,(H2,16,20,21)(H2,17,22,23)(H2,18,19,24) |
| InChIKey | PVSWUJNBHHDSMN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|