C18H13N3O2S — CID 2193178
3-(2,4-dihydroxyphenyl)-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione (PubChem CID 2193178) has the molecular formula C18H13N3O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 3-(2,4-dihydroxyphenyl)-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,4-dihydroxyphenyl)-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2193178 |
| Molecular Formula | C18H13N3O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 3-(2,4-dihydroxyphenyl)-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Oc1ccc(-c2n[nH]c(=S)n2-c2cccc3ccccc23)c(O)c1 |
| InChI | InChI=1S/C18H13N3O2S/c22-12-8-9-14(16(23)10-12)17-19-20-18(24)21(17)15-7-3-5-11-4-1-2-6-13(11)15/h1-10,22-23H,(H,20,24) |
| InChIKey | ISNBTODJGDBLAZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|