C18H15N3O2S — CID 135482208
1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-naphthalen-1-ylthiourea (PubChem CID 135482208) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-naphthalen-1-ylthiourea.
| Compound Name | 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-naphthalen-1-ylthiourea |
|---|---|
| PubChem CID | 135482208 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-naphthalen-1-ylthiourea |
| SMILES | Oc1ccc(/C=N/NC(=S)Nc2cccc3ccccc23)c(O)c1 |
| InChI | InChI=1S/C18H15N3O2S/c22-14-9-8-13(17(23)10-14)11-19-21-18(24)20-16-7-3-5-12-4-1-2-6-15(12)16/h1-11,22-23H,(H2,20,21,24)/b19-11+ |
| InChIKey | DBGIPLVUWNOTCU-YBFXNURJSA-N |
| XLogP | 3.57 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|