C18H18N4OS — CID 2193992
4-[4-(4-ethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]pyridine (PubChem CID 2193992) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 4-[4-(4-ethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[4-(4-ethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 2193992 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-[4-(4-ethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]pyridine |
| SMILES | C=CCSc1nnc(-c2ccncc2)n1-c1ccc(OCC)cc1 |
| InChI | InChI=1S/C18H18N4OS/c1-3-13-24-18-21-20-17(14-9-11-19-12-10-14)22(18)15-5-7-16(8-6-15)23-4-2/h3,5-12H,1,4,13H2,2H3 |
| InChIKey | MAKPWXXDDJLEQT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|