C17H16N4S — CID 124504805
4-[4-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]pyridine (PubChem CID 124504805) has the molecular formula C17H16N4S and a molecular weight of 308.41 g/mol. Its IUPAC name is 4-[4-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[4-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 124504805 |
| Molecular Formula | C17H16N4S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 4-[4-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]pyridine |
| SMILES | C=CCSc1nnc(-c2ccncc2)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C17H16N4S/c1-3-12-22-17-20-19-16(14-8-10-18-11-9-14)21(17)15-6-4-13(2)5-7-15/h3-11H,1,12H2,2H3 |
| InChIKey | GOYCNXANHVDGPH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|