C19H19N3OS — CID 40649310
3-(2-methoxyphenyl)-4-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazole (PubChem CID 40649310) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-4-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazole.
| Compound Name | 3-(2-methoxyphenyl)-4-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 40649310 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-(2-methoxyphenyl)-4-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazole |
| SMILES | C=CCSc1nnc(-c2ccccc2OC)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C19H19N3OS/c1-4-13-24-19-21-20-18(16-7-5-6-8-17(16)23-3)22(19)15-11-9-14(2)10-12-15/h4-12H,1,13H2,2-3H3 |
| InChIKey | YLLPDDJBEVQYMC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|