C18H20N2O3S3 — CID 2195901
ethyl 5-ethyl-2-[(2-phenylsulfanylacetyl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 2195901) has the molecular formula C18H20N2O3S3 and a molecular weight of 408.57 g/mol. Its IUPAC name is ethyl 5-ethyl-2-[(2-phenylsulfanylacetyl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-2-[(2-phenylsulfanylacetyl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2195901 |
| Molecular Formula | C18H20N2O3S3 |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | ethyl 5-ethyl-2-[(2-phenylsulfanylacetyl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=S)NC(=O)CSc1ccccc1 |
| InChI | InChI=1S/C18H20N2O3S3/c1-3-12-10-14(17(22)23-4-2)16(26-12)20-18(24)19-15(21)11-25-13-8-6-5-7-9-13/h5-10H,3-4,11H2,1-2H3,(H2,19,20,21,24) |
| InChIKey | GUJBZVSRQXDHAY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|