C19H21N3O3 — CID 2199936
1-[2-[2-(4-phenylmethoxyphenoxy)ethoxy]ethyl]-1,2,4-triazole (PubChem CID 2199936) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-[2-[2-(4-phenylmethoxyphenoxy)ethoxy]ethyl]-1,2,4-triazole.
| Compound Name | 1-[2-[2-(4-phenylmethoxyphenoxy)ethoxy]ethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 2199936 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[2-[2-(4-phenylmethoxyphenoxy)ethoxy]ethyl]-1,2,4-triazole |
| SMILES | c1ccc(COc2ccc(OCCOCCn3cncn3)cc2)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-2-4-17(5-3-1)14-25-19-8-6-18(7-9-19)24-13-12-23-11-10-22-16-20-15-21-22/h1-9,15-16H,10-14H2 |
| InChIKey | RVALGLAFGAAIPF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|