C16H21N3O2 — CID 2199894
1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-1,2,4-triazole (PubChem CID 2199894) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-1,2,4-triazole.
| Compound Name | 1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 2199894 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-1,2,4-triazole |
| SMILES | C/C=C/c1ccc(OCCCCn2cncn2)c(OC)c1 |
| InChI | InChI=1S/C16H21N3O2/c1-3-6-14-7-8-15(16(11-14)20-2)21-10-5-4-9-19-13-17-12-18-19/h3,6-8,11-13H,4-5,9-10H2,1-2H3/b6-3+ |
| InChIKey | ISTNJRODFRHLQG-ZZXKWVIFSA-N |
| XLogP | 3.18 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|