C17H23N7O3 — CID 22002379
2-[2-[4-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]piperazin-1-yl]ethoxy]ethanol (PubChem CID 22002379) has the molecular formula C17H23N7O3 and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-[2-[4-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]piperazin-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]piperazin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 22002379 |
| Molecular Formula | C17H23N7O3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-[2-[4-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]piperazin-1-yl]ethoxy]ethanol |
| SMILES | Nc1nc(N2CCN(CCOCCO)CC2)cc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C17H23N7O3/c18-17-20-14(23-5-3-22(4-6-23)7-10-26-11-8-25)12-15-19-16(21-24(15)17)13-2-1-9-27-13/h1-2,9,12,25H,3-8,10-11H2,(H2,18,20) |
| InChIKey | VMFXNNYYORZUOX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|