C24H29N7O2 — CID 22002286
7-[3,5-dimethyl-4-(2-phenylmethoxyethyl)piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 22002286) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 7-[3,5-dimethyl-4-(2-phenylmethoxyethyl)piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 7-[3,5-dimethyl-4-(2-phenylmethoxyethyl)piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 22002286 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 7-[3,5-dimethyl-4-(2-phenylmethoxyethyl)piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | CC1CN(c2cc3nc(-c4ccco4)nn3c(N)n2)CC(C)N1CCOCc1ccccc1 |
| InChI | InChI=1S/C24H29N7O2/c1-17-14-29(15-18(2)30(17)10-12-32-16-19-7-4-3-5-8-19)21-13-22-26-23(20-9-6-11-33-20)28-31(22)24(25)27-21/h3-9,11,13,17-18H,10,12,14-16H2,1-2H3,(H2,25,27) |
| InChIKey | BGMDASYCONZJLK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|