C24H20N6O6 — CID 22002462
N-[(3,4-dimethoxyphenyl)methyl]-2-(furan-2-yl)-7-(4-nitrophenoxy)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 22002462) has the molecular formula C24H20N6O6 and a molecular weight of 488.46 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-(furan-2-yl)-7-(4-nitrophenoxy)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(furan-2-yl)-7-(4-nitrophenoxy)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 22002462 |
| Molecular Formula | C24H20N6O6 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(furan-2-yl)-7-(4-nitrophenoxy)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | COc1ccc(CNc2nc(Oc3ccc([N+](=O)[O-])cc3)cc3nc(-c4ccco4)nn23)cc1OC |
| InChI | InChI=1S/C24H20N6O6/c1-33-18-10-5-15(12-20(18)34-2)14-25-24-27-22(36-17-8-6-16(7-9-17)30(31)32)13-21-26-23(28-29(21)24)19-4-3-11-35-19/h3-13H,14H2,1-2H3,(H,25,27) |
| InChIKey | PJDFRFQITPBUKH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|