C30H28N6O4S — CID 139995020
N-[(3,4-dimethoxyphenyl)methyl]-2-(furan-2-yl)-8-[5-[(4-methoxyphenyl)methyl]-2-methyl-1,3-thiazol-4-yl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 139995020) has the molecular formula C30H28N6O4S and a molecular weight of 568.66 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-(furan-2-yl)-8-[5-[(4-methoxyphenyl)methyl]-2-methyl-1,3-thiazol-4-yl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(furan-2-yl)-8-[5-[(4-methoxyphenyl)methyl]-2-methyl-1,3-thiazol-4-yl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 139995020 |
| Molecular Formula | C30H28N6O4S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(furan-2-yl)-8-[5-[(4-methoxyphenyl)methyl]-2-methyl-1,3-thiazol-4-yl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | COc1ccc(Cc2sc(C)nc2-c2cnc(NCc3ccc(OC)c(OC)c3)n3nc(-c4ccco4)nc23)cc1 |
| InChI | InChI=1S/C30H28N6O4S/c1-18-33-27(26(41-18)15-19-7-10-21(37-2)11-8-19)22-17-32-30(31-16-20-9-12-23(38-3)25(14-20)39-4)36-29(22)34-28(35-36)24-6-5-13-40-24/h5-14,17H,15-16H2,1-4H3,(H,31,32) |
| InChIKey | JDLQWRYNOJYJKX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |