C31H31N7O5S — CID 139995003
5-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-[(3,4-dimethoxyphenyl)methylamino]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-1,3-thiazol-2-amine (PubChem CID 139995003) has the molecular formula C31H31N7O5S and a molecular weight of 613.70 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-[(3,4-dimethoxyphenyl)methylamino]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-1,3-thiazol-2-amine.
| Compound Name | 5-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-[(3,4-dimethoxyphenyl)methylamino]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 139995003 |
| Molecular Formula | C31H31N7O5S |
| Molecular Weight | 613.70 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | 5-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-[(3,4-dimethoxyphenyl)methylamino]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(CCc2sc(N)nc2-c2cnc(NCc3ccc(OC)c(OC)c3)n3nc(-c4ccco4)nc23)cc1OC |
| InChI | InChI=1S/C31H31N7O5S/c1-39-21-10-7-18(14-24(21)41-3)9-12-26-27(35-30(32)44-26)20-17-34-31(33-16-19-8-11-22(40-2)25(15-19)42-4)38-29(20)36-28(37-38)23-6-5-13-43-23/h5-8,10-11,13-15,17H,9,12,16H2,1-4H3,(H2,32,35)(H,33,34) |
| InChIKey | SPTGAHGIUIDIEF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |