C13H23F4N2O2+ — CID 22002616
1,3-dibutyl-2-fluoro-4,5-dihydro-1H-imidazole-1,3-diium;2,2,2-trifluoroacetate (PubChem CID 22002616) has the molecular formula C13H23F4N2O2+ and a molecular weight of 315.33 g/mol. Its IUPAC name is 1,3-dibutyl-2-fluoro-4,5-dihydro-1H-imidazole-1,3-diium;2,2,2-trifluoroacetate.
| Compound Name | 1,3-dibutyl-2-fluoro-4,5-dihydro-1H-imidazole-1,3-diium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 22002616 |
| Molecular Formula | C13H23F4N2O2+ |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1,3-dibutyl-2-fluoro-4,5-dihydro-1H-imidazole-1,3-diium;2,2,2-trifluoroacetate |
| SMILES | CCCC[N+]1=C(F)[NH+](CCCC)CC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C11H22FN2.C2HF3O2/c1-3-5-7-13-9-10-14(11(13)12)8-6-4-2;3-2(4,5)1(6)7/h3-10H2,1-2H3;(H,6,7)/q+1; |
| InChIKey | LETSGUIGJKZPKP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|