C12H16IN3O — CID 22008221
(3,4-diaminopiperidin-1-yl)-(2-iodophenyl)methanone (PubChem CID 22008221) has the molecular formula C12H16IN3O and a molecular weight of 345.18 g/mol. Its IUPAC name is (3,4-diaminopiperidin-1-yl)-(2-iodophenyl)methanone.
| Compound Name | (3,4-diaminopiperidin-1-yl)-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 22008221 |
| Molecular Formula | C12H16IN3O |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | (3,4-diaminopiperidin-1-yl)-(2-iodophenyl)methanone |
| SMILES | NC1CCN(C(=O)c2ccccc2I)CC1N |
| InChI | InChI=1S/C12H16IN3O/c13-9-4-2-1-3-8(9)12(17)16-6-5-10(14)11(15)7-16/h1-4,10-11H,5-7,14-15H2 |
| InChIKey | FPNDZMZFEMFFHG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|