About 1,3-dioxepane-2,2-diamine
1,3-dioxepane-2,2-diamine (PubChem CID 22008226) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is 1,3-dioxepane-2,2-diamine.
Molecular Properties
| Compound Name | 1,3-dioxepane-2,2-diamine |
| PubChem CID | 22008226 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 1,3-dioxepane-2,2-diamine |
| SMILES | NC1(N)OCCCCO1 |
| InChI | InChI=1S/C5H12N2O2/c6-5(7)8-3-1-2-4-9-5/h1-4,6-7H2 |
| InChIKey | SVDCJXOEIKRAKO-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dioxepane-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxepane-2,2-diamine?
The IUPAC name of 1,3-dioxepane-2,2-diamine (CID 22008226) is 1,3-dioxepane-2,2-diamine.
What is the SMILES notation for 1,3-dioxepane-2,2-diamine?
The canonical SMILES for 1,3-dioxepane-2,2-diamine is NC1(N)OCCCCO1.
What is the InChIKey of 1,3-dioxepane-2,2-diamine?
The InChIKey is SVDCJXOEIKRAKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c6-5(7)8-3-1-2-4-9-5/h1-4,6-7H2.
What are the key properties of 1,3-dioxepane-2,2-diamine?
1,3-dioxepane-2,2-diamine has a molecular weight of 132.16 g/mol, XLogP of -0.66, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxepane-2,2-diamine is sourced from PubChem (CID 22008226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).