C21H24N2O8 — CID 22009032
3-O-ethyl 5-O-methyl 2-(2-ethoxy-2-oxoethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 22009032) has the molecular formula C21H24N2O8 and a molecular weight of 432.43 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl 2-(2-ethoxy-2-oxoethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-methyl 2-(2-ethoxy-2-oxoethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 22009032 |
| Molecular Formula | C21H24N2O8 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-O-ethyl 5-O-methyl 2-(2-ethoxy-2-oxoethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)CC1=C(C(=O)OCC)CC(C(=O)OC)=C(C)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H24N2O8/c1-5-30-19(24)12-18-17(21(26)31-6-2)11-16(20(25)29-4)13(3)22(18)14-7-9-15(10-8-14)23(27)28/h7-10H,5-6,11-12H2,1-4H3 |
| InChIKey | QJRFPKXTSQVAKU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|