C32H39F4NO2Si — CID 22011968
[5-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)-2-propan-2-yl-5,6,7,8-tetrahydroquinolin-3-yl]-(2,3,5-trifluoro-4-methylphenyl)methanol (PubChem CID 22011968) has the molecular formula C32H39F4NO2Si and a molecular weight of 573.75 g/mol. Its IUPAC name is [5-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)-2-propan-2-yl-5,6,7,8-tetrahydroquinolin-3-yl]-(2,3,5-trifluoro-4-methylphenyl)methanol.
| Compound Name | [5-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)-2-propan-2-yl-5,6,7,8-tetrahydroquinolin-3-yl]-(2,3,5-trifluoro-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 22011968 |
| Molecular Formula | C32H39F4NO2Si |
| Molecular Weight | 573.75 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)-2-propan-2-yl-5,6,7,8-tetrahydroquinolin-3-yl]-(2,3,5-trifluoro-4-methylphenyl)methanol |
| SMILES | Cc1c(F)cc(C(O)c2c(C(C)C)nc3c(c2-c2ccc(F)cc2)C(O[Si](C)(C)C(C)(C)C)CCC3)c(F)c1F |
| InChI | InChI=1S/C32H39F4NO2Si/c1-17(2)30-27(31(38)21-16-22(34)18(3)28(35)29(21)36)25(19-12-14-20(33)15-13-19)26-23(37-30)10-9-11-24(26)39-40(7,8)32(4,5)6/h12-17,24,31,38H,9-11H2,1-8H3 |
| InChIKey | FUGLNPSHWQAEGH-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.75 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|