C29H25BrF2N4O4S2 — CID 22017744
N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-(2-ethylsulfonylethoxymethyl)-1,3-thiazol-4-yl]-7-fluoroquinazolin-4-amine (PubChem CID 22017744) has the molecular formula C29H25BrF2N4O4S2 and a molecular weight of 675.58 g/mol. Its IUPAC name is N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-(2-ethylsulfonylethoxymethyl)-1,3-thiazol-4-yl]-7-fluoroquinazolin-4-amine.
| Compound Name | N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-(2-ethylsulfonylethoxymethyl)-1,3-thiazol-4-yl]-7-fluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 22017744 |
| Molecular Formula | C29H25BrF2N4O4S2 |
| Molecular Weight | 675.58 g/mol |
| Exact Mass | 674.05 |
| IUPAC Name | N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-(2-ethylsulfonylethoxymethyl)-1,3-thiazol-4-yl]-7-fluoroquinazolin-4-amine |
| SMILES | CCS(=O)(=O)CCOCc1nc(-c2cc3c(Nc4ccc(OCc5cccc(F)c5)c(Br)c4)ncnc3cc2F)cs1 |
| InChI | InChI=1S/C29H25BrF2N4O4S2/c1-2-42(37,38)9-8-39-15-28-36-26(16-41-28)21-12-22-25(13-24(21)32)33-17-34-29(22)35-20-6-7-27(23(30)11-20)40-14-18-4-3-5-19(31)10-18/h3-7,10-13,16-17H,2,8-9,14-15H2,1H3,(H,33,34,35) |
| InChIKey | ISXMDOVCUBHUIA-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.58 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|