C31H31BrFN5O3S2 — CID 68872664
N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-ethylsulfonylethylamino)propyl]-1,3-thiazol-4-yl]quinazolin-4-amine (PubChem CID 68872664) has the molecular formula C31H31BrFN5O3S2 and a molecular weight of 684.66 g/mol. Its IUPAC name is N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-ethylsulfonylethylamino)propyl]-1,3-thiazol-4-yl]quinazolin-4-amine.
| Compound Name | N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-ethylsulfonylethylamino)propyl]-1,3-thiazol-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68872664 |
| Molecular Formula | C31H31BrFN5O3S2 |
| Molecular Weight | 684.66 g/mol |
| Exact Mass | 683.10 |
| IUPAC Name | N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-ethylsulfonylethylamino)propyl]-1,3-thiazol-4-yl]quinazolin-4-amine |
| SMILES | CCS(=O)(=O)CCNCCCc1nc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Br)c4)c3c2)cs1 |
| InChI | InChI=1S/C31H31BrFN5O3S2/c1-2-43(39,40)14-13-34-12-4-7-30-38-28(19-42-30)22-8-10-27-25(16-22)31(36-20-35-27)37-24-9-11-29(26(32)17-24)41-18-21-5-3-6-23(33)15-21/h3,5-6,8-11,15-17,19-20,34H,2,4,7,12-14,18H2,1H3,(H,35,36,37) |
| InChIKey | HZWDLBFWLLCDPH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.66 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|