C22H26N2O3 — CID 22018422
[6-[1-hydroxy-1-(1H-imidazol-5-yl)-2-methylpropyl]naphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 22018422) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is [6-[1-hydroxy-1-(1H-imidazol-5-yl)-2-methylpropyl]naphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [6-[1-hydroxy-1-(1H-imidazol-5-yl)-2-methylpropyl]naphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 22018422 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [6-[1-hydroxy-1-(1H-imidazol-5-yl)-2-methylpropyl]naphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)C(O)(c1ccc2cc(OC(=O)C(C)(C)C)ccc2c1)c1cnc[nH]1 |
| InChI | InChI=1S/C22H26N2O3/c1-14(2)22(26,19-12-23-13-24-19)17-8-6-16-11-18(9-7-15(16)10-17)27-20(25)21(3,4)5/h6-14,26H,1-5H3,(H,23,24) |
| InChIKey | MPISTYZWOBHDJW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|