C38H36N6O4S — CID 22018585
N-[[4-[[1H-indol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-2-nitro-N-(pyridin-2-ylmethyl)benzenesulfonamide (PubChem CID 22018585) has the molecular formula C38H36N6O4S and a molecular weight of 672.81 g/mol. Its IUPAC name is N-[[4-[[1H-indol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-2-nitro-N-(pyridin-2-ylmethyl)benzenesulfonamide.
| Compound Name | N-[[4-[[1H-indol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-2-nitro-N-(pyridin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22018585 |
| Molecular Formula | C38H36N6O4S |
| Molecular Weight | 672.81 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | N-[[4-[[1H-indol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-2-nitro-N-(pyridin-2-ylmethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N(Cc1ccc(CN(Cc2cc3ccccc3[nH]2)C2CCCc3cccnc32)cc1)Cc1ccccn1 |
| InChI | InChI=1S/C38H36N6O4S/c45-44(46)35-14-3-4-16-37(35)49(47,48)43(27-32-12-5-6-21-39-32)25-29-19-17-28(18-20-29)24-42(26-33-23-31-9-1-2-13-34(31)41-33)36-15-7-10-30-11-8-22-40-38(30)36/h1-6,8-9,11-14,16-23,36,41H,7,10,15,24-27H2 |
| InChIKey | PZTJBSQGMRNFGK-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.81 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|