C21H21N3O7S2 — CID 86597124
[4-[[(2-nitrophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]methyl methanesulfonate (PubChem CID 86597124) has the molecular formula C21H21N3O7S2 and a molecular weight of 491.55 g/mol. Its IUPAC name is [4-[[(2-nitrophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]methyl methanesulfonate.
| Compound Name | [4-[[(2-nitrophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 86597124 |
| Molecular Formula | C21H21N3O7S2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | [4-[[(2-nitrophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1ccc(CN(Cc2ccccn2)S(=O)(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21N3O7S2/c1-32(27,28)31-16-18-11-9-17(10-12-18)14-23(15-19-6-4-5-13-22-19)33(29,30)21-8-3-2-7-20(21)24(25)26/h2-13H,14-16H2,1H3 |
| InChIKey | WHFPPCHHACWWMY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|