C22H27IN2O5 — CID 22019609
tert-butyl N-[2-[4-[2-(3-iodoanilino)-2-oxoethyl]-2-methoxyphenoxy]ethyl]carbamate (PubChem CID 22019609) has the molecular formula C22H27IN2O5 and a molecular weight of 526.37 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[2-(3-iodoanilino)-2-oxoethyl]-2-methoxyphenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[2-(3-iodoanilino)-2-oxoethyl]-2-methoxyphenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 22019609 |
| Molecular Formula | C22H27IN2O5 |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | tert-butyl N-[2-[4-[2-(3-iodoanilino)-2-oxoethyl]-2-methoxyphenoxy]ethyl]carbamate |
| SMILES | COc1cc(CC(=O)Nc2cccc(I)c2)ccc1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27IN2O5/c1-22(2,3)30-21(27)24-10-11-29-18-9-8-15(12-19(18)28-4)13-20(26)25-17-7-5-6-16(23)14-17/h5-9,12,14H,10-11,13H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | MHKHICUDLCDHEB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|