C24H17FN4O2 — CID 22021872
N-benzyl-3-(6-fluoro-3-oxo-1H-pyrazolo[4,3-c]quinolin-2-yl)benzamide (PubChem CID 22021872) has the molecular formula C24H17FN4O2 and a molecular weight of 412.42 g/mol. Its IUPAC name is N-benzyl-3-(6-fluoro-3-oxo-1H-pyrazolo[4,3-c]quinolin-2-yl)benzamide.
| Compound Name | N-benzyl-3-(6-fluoro-3-oxo-1H-pyrazolo[4,3-c]quinolin-2-yl)benzamide |
|---|---|
| PubChem CID | 22021872 |
| Molecular Formula | C24H17FN4O2 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-benzyl-3-(6-fluoro-3-oxo-1H-pyrazolo[4,3-c]quinolin-2-yl)benzamide |
| SMILES | O=C(NCc1ccccc1)c1cccc(-n2[nH]c3c(cnc4c(F)cccc43)c2=O)c1 |
| InChI | InChI=1S/C24H17FN4O2/c25-20-11-5-10-18-21-19(14-26-22(18)20)24(31)29(28-21)17-9-4-8-16(12-17)23(30)27-13-15-6-2-1-3-7-15/h1-12,14,28H,13H2,(H,27,30) |
| InChIKey | PTWYVHDARDXUQL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|