About imino(dioxido)azanium;piperazine
imino(dioxido)azanium;piperazine (PubChem CID 22022818) has the molecular formula C4H11N4O2-
and a molecular weight of 147.16 g/mol. Its IUPAC name is imino(dioxido)azanium;piperazine.
Molecular Properties
| Compound Name | imino(dioxido)azanium;piperazine |
| PubChem CID | 22022818 |
| Molecular Formula | C4H11N4O2- |
| Molecular Weight | 147.16 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | imino(dioxido)azanium;piperazine |
| SMILES | C1CNCCN1.[H]N=[N+]([O-])[O-] |
| InChI | InChI=1S/C4H10N2.HN2O2/c1-2-6-4-3-5-1;1-2(3)4/h5-6H,1-4H2;(H-,1,3,4)/q;-1 |
| InChIKey | WJISMNUUABBGRN-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.16 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze imino(dioxido)azanium;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino(dioxido)azanium;piperazine?
The IUPAC name of imino(dioxido)azanium;piperazine (CID 22022818) is imino(dioxido)azanium;piperazine.
What is the SMILES notation for imino(dioxido)azanium;piperazine?
The canonical SMILES for imino(dioxido)azanium;piperazine is C1CNCCN1.[H]N=[N+]([O-])[O-].
What is the InChIKey of imino(dioxido)azanium;piperazine?
The InChIKey is WJISMNUUABBGRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2.HN2O2/c1-2-6-4-3-5-1;1-2(3)4/h5-6H,1-4H2;(H-,1,3,4)/q;-1.
What are the key properties of imino(dioxido)azanium;piperazine?
imino(dioxido)azanium;piperazine has a molecular weight of 147.16 g/mol, XLogP of -0.80, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imino(dioxido)azanium;piperazine is sourced from PubChem (CID 22022818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).