C24H32Cl2N4 — CID 22024521
8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine (PubChem CID 22024521) has the molecular formula C24H32Cl2N4 and a molecular weight of 447.45 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine.
| Compound Name | 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine |
|---|---|
| PubChem CID | 22024521 |
| Molecular Formula | C24H32Cl2N4 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine |
| SMILES | CCCCCN(CCC(C)C)c1c(CC)nc2c(-c3ccc(Cl)cc3Cl)nccn12 |
| InChI | InChI=1S/C24H32Cl2N4/c1-5-7-8-13-29(14-11-17(3)4)24-21(6-2)28-23-22(27-12-15-30(23)24)19-10-9-18(25)16-20(19)26/h9-10,12,15-17H,5-8,11,13-14H2,1-4H3 |
| InChIKey | IEIBDPJJTAJAOU-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|