About 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine
8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine (PubChem CID 22024521) has the molecular formula C24H32Cl2N4
and a molecular weight of 447.45 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine.
Molecular Properties
| Compound Name | 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine |
| PubChem CID | 22024521 |
| Molecular Formula | C24H32Cl2N4 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine |
| SMILES | CCCCCN(CCC(C)C)c1c(CC)nc2c(-c3ccc(Cl)cc3Cl)nccn12 |
| InChI | InChI=1S/C24H32Cl2N4/c1-5-7-8-13-29(14-11-17(3)4)24-21(6-2)28-23-22(27-12-15-30(23)24)19-10-9-18(25)16-20(19)26/h9-10,12,15-17H,5-8,11,13-14H2,1-4H3 |
| InChIKey | IEIBDPJJTAJAOU-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine?
The IUPAC name of 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine (CID 22024521) is 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine.
What is the SMILES notation for 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine?
The canonical SMILES for 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine is CCCCCN(CCC(C)C)c1c(CC)nc2c(-c3ccc(Cl)cc3Cl)nccn12.
What is the InChIKey of 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine?
The InChIKey is IEIBDPJJTAJAOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32Cl2N4/c1-5-7-8-13-29(14-11-17(3)4)24-21(6-2)28-23-22(27-12-15-30(23)24)19-10-9-18(25)16-20(19)26/h9-10,12,15-17H,5-8,11,13-14H2,1-4H3.
What are the key properties of 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine?
8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine has a molecular weight of 447.45 g/mol, XLogP of 7.31, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,4-dichlorophenyl)-2-ethyl-N-(3-methylbutyl)-N-pentylimidazo[1,2-a]pyrazin-3-amine is sourced from PubChem (CID 22024521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).