C21H22N4O4 — CID 22025167
1-methyl-7-[[2-(4-methylpiperazine-1-carbonyl)-4-pyridinyl]oxy]indole-2-carboxylic acid (PubChem CID 22025167) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 1-methyl-7-[[2-(4-methylpiperazine-1-carbonyl)-4-pyridinyl]oxy]indole-2-carboxylic acid.
| Compound Name | 1-methyl-7-[[2-(4-methylpiperazine-1-carbonyl)-4-pyridinyl]oxy]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 22025167 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-methyl-7-[[2-(4-methylpiperazine-1-carbonyl)-4-pyridinyl]oxy]indole-2-carboxylic acid |
| SMILES | CN1CCN(C(=O)c2cc(Oc3cccc4cc(C(=O)O)n(C)c34)ccn2)CC1 |
| InChI | InChI=1S/C21H22N4O4/c1-23-8-10-25(11-9-23)20(26)16-13-15(6-7-22-16)29-18-5-3-4-14-12-17(21(27)28)24(2)19(14)18/h3-7,12-13H,8-11H2,1-2H3,(H,27,28) |
| InChIKey | XNIUBTAVDZZCBR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |