C22H27N5O3 — CID 22025243
7-[2-(4-tert-butylpiperazin-1-yl)pyrimidin-4-yl]oxy-1-methylindole-2-carboxylic acid (PubChem CID 22025243) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 7-[2-(4-tert-butylpiperazin-1-yl)pyrimidin-4-yl]oxy-1-methylindole-2-carboxylic acid.
| Compound Name | 7-[2-(4-tert-butylpiperazin-1-yl)pyrimidin-4-yl]oxy-1-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 22025243 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 7-[2-(4-tert-butylpiperazin-1-yl)pyrimidin-4-yl]oxy-1-methylindole-2-carboxylic acid |
| SMILES | Cn1c(C(=O)O)cc2cccc(Oc3ccnc(N4CCN(C(C)(C)C)CC4)n3)c21 |
| InChI | InChI=1S/C22H27N5O3/c1-22(2,3)27-12-10-26(11-13-27)21-23-9-8-18(24-21)30-17-7-5-6-15-14-16(20(28)29)25(4)19(15)17/h5-9,14H,10-13H2,1-4H3,(H,28,29) |
| InChIKey | WWGGABPCVKRVMH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |