C18H20N4O3 — CID 22025260
7-[2-[2-(dimethylamino)ethyl]pyrimidin-4-yl]oxy-1-methylindole-2-carboxylic acid (PubChem CID 22025260) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 7-[2-[2-(dimethylamino)ethyl]pyrimidin-4-yl]oxy-1-methylindole-2-carboxylic acid.
| Compound Name | 7-[2-[2-(dimethylamino)ethyl]pyrimidin-4-yl]oxy-1-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 22025260 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 7-[2-[2-(dimethylamino)ethyl]pyrimidin-4-yl]oxy-1-methylindole-2-carboxylic acid |
| SMILES | CN(C)CCc1nccc(Oc2cccc3cc(C(=O)O)n(C)c23)n1 |
| InChI | InChI=1S/C18H20N4O3/c1-21(2)10-8-15-19-9-7-16(20-15)25-14-6-4-5-12-11-13(18(23)24)22(3)17(12)14/h4-7,9,11H,8,10H2,1-3H3,(H,23,24) |
| InChIKey | ZUHNZQJDNWKCPL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |