C33H34F2N2O7 — CID 22025520
7-[2-(3,4-difluorophenyl)-4-[(2,4-dihydroxyphenyl)carbamoyl]-3-phenyl-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 22025520) has the molecular formula C33H34F2N2O7 and a molecular weight of 608.64 g/mol. Its IUPAC name is 7-[2-(3,4-difluorophenyl)-4-[(2,4-dihydroxyphenyl)carbamoyl]-3-phenyl-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | 7-[2-(3,4-difluorophenyl)-4-[(2,4-dihydroxyphenyl)carbamoyl]-3-phenyl-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 22025520 |
| Molecular Formula | C33H34F2N2O7 |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | 7-[2-(3,4-difluorophenyl)-4-[(2,4-dihydroxyphenyl)carbamoyl]-3-phenyl-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CC(C)c1c(C(=O)Nc2ccc(O)cc2O)c(-c2ccccc2)c(-c2ccc(F)c(F)c2)n1CCC(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C33H34F2N2O7/c1-18(2)31-30(33(44)36-26-11-9-21(38)16-27(26)41)29(19-6-4-3-5-7-19)32(20-8-10-24(34)25(35)14-20)37(31)13-12-22(39)15-23(40)17-28(42)43/h3-11,14,16,18,22-23,38-41H,12-13,15,17H2,1-2H3,(H,36,44)(H,42,43) |
| InChIKey | IIKLATHVTLIBTB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 152.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|