C17H22O3S — CID 22026134
ethyl 6-[(4-methoxyphenyl)methylsulfanyl]cyclohexene-1-carboxylate (PubChem CID 22026134) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is ethyl 6-[(4-methoxyphenyl)methylsulfanyl]cyclohexene-1-carboxylate.
| Compound Name | ethyl 6-[(4-methoxyphenyl)methylsulfanyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 22026134 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | ethyl 6-[(4-methoxyphenyl)methylsulfanyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC1SCc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H22O3S/c1-3-20-17(18)15-6-4-5-7-16(15)21-12-13-8-10-14(19-2)11-9-13/h6,8-11,16H,3-5,7,12H2,1-2H3 |
| InChIKey | NUFQKIZGYPLJOA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |