C16H11BrF2N4O3S2 — CID 22027893
N-[4-[5-[(4-bromo-2,5-difluorophenyl)sulfonylamino]-1,3,4-thiadiazol-2-yl]phenyl]acetamide (PubChem CID 22027893) has the molecular formula C16H11BrF2N4O3S2 and a molecular weight of 489.32 g/mol. Its IUPAC name is N-[4-[5-[(4-bromo-2,5-difluorophenyl)sulfonylamino]-1,3,4-thiadiazol-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[5-[(4-bromo-2,5-difluorophenyl)sulfonylamino]-1,3,4-thiadiazol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 22027893 |
| Molecular Formula | C16H11BrF2N4O3S2 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 487.94 |
| IUPAC Name | N-[4-[5-[(4-bromo-2,5-difluorophenyl)sulfonylamino]-1,3,4-thiadiazol-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2nnc(NS(=O)(=O)c3cc(F)c(Br)cc3F)s2)cc1 |
| InChI | InChI=1S/C16H11BrF2N4O3S2/c1-8(24)20-10-4-2-9(3-5-10)15-21-22-16(27-15)23-28(25,26)14-7-12(18)11(17)6-13(14)19/h2-7H,1H3,(H,20,24)(H,22,23) |
| InChIKey | NQXKPANCJFNQKD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|