C20H16BrF2N3O3S2 — CID 174460965
N-[4-[2-[1-(4-bromo-2,5-difluorophenyl)prop-2-enylsulfonylamino]-1,3-thiazol-4-yl]phenyl]acetamide (PubChem CID 174460965) has the molecular formula C20H16BrF2N3O3S2 and a molecular weight of 528.40 g/mol. Its IUPAC name is N-[4-[2-[1-(4-bromo-2,5-difluorophenyl)prop-2-enylsulfonylamino]-1,3-thiazol-4-yl]phenyl]acetamide.
| Compound Name | N-[4-[2-[1-(4-bromo-2,5-difluorophenyl)prop-2-enylsulfonylamino]-1,3-thiazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 174460965 |
| Molecular Formula | C20H16BrF2N3O3S2 |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 526.98 |
| IUPAC Name | N-[4-[2-[1-(4-bromo-2,5-difluorophenyl)prop-2-enylsulfonylamino]-1,3-thiazol-4-yl]phenyl]acetamide |
| SMILES | C=CC(c1cc(F)c(Br)cc1F)S(=O)(=O)Nc1nc(-c2ccc(NC(C)=O)cc2)cs1 |
| InChI | InChI=1S/C20H16BrF2N3O3S2/c1-3-19(14-8-17(23)15(21)9-16(14)22)31(28,29)26-20-25-18(10-30-20)12-4-6-13(7-5-12)24-11(2)27/h3-10,19H,1H2,2H3,(H,24,27)(H,25,26) |
| InChIKey | NRYLCAGANBAFKX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|