C21H17N3O4 — CID 22030623
(E)-3-[6-methoxy-4-[(2-methyl-1H-indol-5-yl)oxy]quinazolin-7-yl]prop-2-enoic acid (PubChem CID 22030623) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is (E)-3-[6-methoxy-4-[(2-methyl-1H-indol-5-yl)oxy]quinazolin-7-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-methoxy-4-[(2-methyl-1H-indol-5-yl)oxy]quinazolin-7-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22030623 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (E)-3-[6-methoxy-4-[(2-methyl-1H-indol-5-yl)oxy]quinazolin-7-yl]prop-2-enoic acid |
| SMILES | COc1cc2c(Oc3ccc4[nH]c(C)cc4c3)ncnc2cc1/C=C/C(=O)O |
| InChI | InChI=1S/C21H17N3O4/c1-12-7-14-8-15(4-5-17(14)24-12)28-21-16-10-19(27-2)13(3-6-20(25)26)9-18(16)22-11-23-21/h3-11,24H,1-2H3,(H,25,26)/b6-3+ |
| InChIKey | WJCUZRAEPQUAPW-ZZXKWVIFSA-N |
| XLogP | 4.32 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|