C36H27N5O2 — CID 22031097
methyl 6-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]pyridine-3-carboxylate (PubChem CID 22031097) has the molecular formula C36H27N5O2 and a molecular weight of 561.65 g/mol. Its IUPAC name is methyl 6-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 22031097 |
| Molecular Formula | C36H27N5O2 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | methyl 6-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(-c2cnc3ccc(-c4cnn(C(c5ccccc5)(c5ccccc5)c5ccccc5)c4)cn23)nc1 |
| InChI | InChI=1S/C36H27N5O2/c1-43-35(42)26-17-19-32(37-21-26)33-23-38-34-20-18-27(24-40(33)34)28-22-39-41(25-28)36(29-11-5-2-6-12-29,30-13-7-3-8-14-30)31-15-9-4-10-16-31/h2-25H,1H3 |
| InChIKey | KJSZGZYSXHDODD-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|