ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate

C16H12BrFN2O2 — CID 22032276

IUPACethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate
SMILESCCOC(=O)c1ccc(-c2cnc3ccc(Br)cn23)cc1F
InChIInChI=1S/C16H12BrFN2O2/c1-2-22-16(21)12-5-3-10(7-13(12)18)14-8-19-15-6-4-11(17)9-20(14)15/h3-9H,2H2,1H3
InChIKeyLTZGYMXOJHHFTA-UHFFFAOYSA-N
MW363.19 g/mol
LogP4.08
Rot. Bonds3

About ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate

ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate (PubChem CID 22032276) has the molecular formula C16H12BrFN2O2 and a molecular weight of 363.19 g/mol. Its IUPAC name is ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate.

Molecular Properties

Compound Nameethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate
PubChem CID22032276
Molecular FormulaC16H12BrFN2O2
Molecular Weight363.19 g/mol
Exact Mass362.01
IUPAC Nameethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate
SMILESCCOC(=O)c1ccc(-c2cnc3ccc(Br)cn23)cc1F
InChIInChI=1S/C16H12BrFN2O2/c1-2-22-16(21)12-5-3-10(7-13(12)18)14-8-19-15-6-4-11(17)9-20(14)15/h3-9H,2H2,1H3
InChIKeyLTZGYMXOJHHFTA-UHFFFAOYSA-N
XLogP4.08
TPSA43.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.19
LogP ≤ 54.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate?
The IUPAC name of ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate (CID 22032276) is ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate.
What is the SMILES notation for ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate?
The canonical SMILES for ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate is CCOC(=O)c1ccc(-c2cnc3ccc(Br)cn23)cc1F.
What is the InChIKey of ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate?
The InChIKey is LTZGYMXOJHHFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrFN2O2/c1-2-22-16(21)12-5-3-10(7-13(12)18)14-8-19-15-6-4-11(17)9-20(14)15/h3-9H,2H2,1H3.
What are the key properties of ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate?
ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate has a molecular weight of 363.19 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(6-bromoimidazo[1,2-a]pyridin-3-yl)-2-fluorobenzoate is sourced from PubChem (CID 22032276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).